C29H24F3N4O4- — CID 5052531
4-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoate (PubChem CID 5052531) has the molecular formula C29H24F3N4O4- and a molecular weight of 549.53 g/mol. Its IUPAC name is 4-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoate.
| Compound Name | 4-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoate |
|---|---|
| PubChem CID | 5052531 |
| Molecular Formula | C29H24F3N4O4- |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 4-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoate |
| SMILES | O=C([O-])CCCNc1cc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c2noc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C29H25F3N4O4/c30-29(31,32)17-5-3-6-18(15-17)35-11-13-36(14-12-35)22-16-21(33-10-4-9-23(37)38)24-25-26(22)34-40-28(25)20-8-2-1-7-19(20)27(24)39/h1-3,5-8,15-16,33H,4,9-14H2,(H,37,38)/p-1 |
| InChIKey | PLUHBWRFKPVAMI-UHFFFAOYSA-M |
| XLogP | 4.33 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|