C15H12BrN5O2S — CID 5052824
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 5052824) has the molecular formula C15H12BrN5O2S and a molecular weight of 406.27 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5052824 |
| Molecular Formula | C15H12BrN5O2S |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Nc1nnc(CC(=O)NN=Cc2ccc(-c3ccc(Br)cc3)o2)s1 |
| InChI | InChI=1S/C15H12BrN5O2S/c16-10-3-1-9(2-4-10)12-6-5-11(23-12)8-18-19-13(22)7-14-20-21-15(17)24-14/h1-6,8H,7H2,(H2,17,21)(H,19,22) |
| InChIKey | MRHBGPXXORCANR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|