C26H25Cl2NO4 — CID 505572
tert-butyl 4-[(3,5-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate (PubChem CID 505572) has the molecular formula C26H25Cl2NO4 and a molecular weight of 486.40 g/mol. Its IUPAC name is tert-butyl 4-[(3,5-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[(3,5-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505572 |
| Molecular Formula | C26H25Cl2NO4 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | tert-butyl 4-[(3,5-dichlorophenyl)methyl-(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1cc(Cl)cc(Cl)c1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H25Cl2NO4/c1-26(2,3)33-25(32)23(30)14-24(31)29(16-18-11-21(27)13-22(28)12-18)15-17-8-9-19-6-4-5-7-20(19)10-17/h4-13H,14-16H2,1-3H3 |
| InChIKey | KEWQGAUNVGJUSW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|