C20H24BrN3 — CID 5060114
1-(3-bromophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]ethanimine (PubChem CID 5060114) has the molecular formula C20H24BrN3 and a molecular weight of 386.34 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]ethanimine.
| Compound Name | 1-(3-bromophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]ethanimine |
|---|---|
| PubChem CID | 5060114 |
| Molecular Formula | C20H24BrN3 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(3-bromophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]ethanimine |
| SMILES | CC(=NN1CCN(Cc2ccc(C)cc2)CC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H24BrN3/c1-16-6-8-18(9-7-16)15-23-10-12-24(13-11-23)22-17(2)19-4-3-5-20(21)14-19/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | STTPHRAAXPBHOX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|