C17H12N3O4S2- — CID 5060501
2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]iminomethyl]benzoate (PubChem CID 5060501) has the molecular formula C17H12N3O4S2- and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]iminomethyl]benzoate.
| Compound Name | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 5060501 |
| Molecular Formula | C17H12N3O4S2- |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]iminomethyl]benzoate |
| SMILES | O=C([O-])c1ccccc1/C=N/c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H13N3O4S2/c21-16(22)15-4-2-1-3-12(15)11-19-13-5-7-14(8-6-13)26(23,24)20-17-18-9-10-25-17/h1-11H,(H,18,20)(H,21,22)/p-1/b19-11+ |
| InChIKey | DZLDONGXMDSODI-YBFXNURJSA-M |
| XLogP | 2.06 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|