C15H20N2O4 — CID 5062886
[2-(cycloheptylamino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 5062886) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 5062886 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]c1=O)NC1CCCCCC1 |
| InChI | InChI=1S/C15H20N2O4/c18-13(17-11-6-3-1-2-4-7-11)10-21-15(20)12-8-5-9-16-14(12)19/h5,8-9,11H,1-4,6-7,10H2,(H,16,19)(H,17,18) |
| InChIKey | UBSGLVOYDIZWJW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |