C12H12F13NO — CID 5063618
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-pentylheptanamide (PubChem CID 5063618) has the molecular formula C12H12F13NO and a molecular weight of 433.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-pentylheptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-pentylheptanamide |
|---|---|
| PubChem CID | 5063618 |
| Molecular Formula | C12H12F13NO |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-pentylheptanamide |
| SMILES | CCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F13NO/c1-2-3-4-5-26-6(27)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h2-5H2,1H3,(H,26,27) |
| InChIKey | QMLCEZRSHHVFBX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|