C34H26Br4 — CID 5064576
1,2,4,5-tetrakis[4-(bromomethyl)phenyl]benzene (PubChem CID 5064576) has the molecular formula C34H26Br4 and a molecular weight of 754.20 g/mol. Its IUPAC name is 1,2,4,5-tetrakis[4-(bromomethyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrakis[4-(bromomethyl)phenyl]benzene |
|---|---|
| PubChem CID | 5064576 |
| Molecular Formula | C34H26Br4 |
| Molecular Weight | 754.20 g/mol |
| Exact Mass | 749.88 |
| IUPAC Name | 1,2,4,5-tetrakis[4-(bromomethyl)phenyl]benzene |
| SMILES | BrCc1ccc(-c2cc(-c3ccc(CBr)cc3)c(-c3ccc(CBr)cc3)cc2-c2ccc(CBr)cc2)cc1 |
| InChI | InChI=1S/C34H26Br4/c35-19-23-1-9-27(10-2-23)31-17-33(29-13-5-25(21-37)6-14-29)34(30-15-7-26(22-38)8-16-30)18-32(31)28-11-3-24(20-36)4-12-28/h1-18H,19-22H2 |
| InChIKey | KMXPXZNPXOGVRP-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.20 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|