C11H8Br2O2 — CID 506547
4-(3,4-dibromophenyl)-2-methyl-2H-furan-5-one (PubChem CID 506547) has the molecular formula C11H8Br2O2 and a molecular weight of 331.99 g/mol. Its IUPAC name is 4-(3,4-dibromophenyl)-2-methyl-2H-furan-5-one.
| Compound Name | 4-(3,4-dibromophenyl)-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 506547 |
| Molecular Formula | C11H8Br2O2 |
| Molecular Weight | 331.99 g/mol |
| Exact Mass | 329.89 |
| IUPAC Name | 4-(3,4-dibromophenyl)-2-methyl-2H-furan-5-one |
| SMILES | CC1C=C(c2ccc(Br)c(Br)c2)C(=O)O1 |
| InChI | InChI=1S/C11H8Br2O2/c1-6-4-8(11(14)15-6)7-2-3-9(12)10(13)5-7/h2-6H,1H3 |
| InChIKey | OMCBJHNPHXUIEO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |