C20H28N2O2S2 — CID 5066342
N-(3-cyclohexylsulfanylpropyl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide (PubChem CID 5066342) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide |
|---|---|
| PubChem CID | 5066342 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)propanamide |
| SMILES | CC(C(=O)NCCCSC1CCCCC1)C1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C20H28N2O2S2/c1-14(18-20(24)22-16-10-5-6-11-17(16)26-18)19(23)21-12-7-13-25-15-8-3-2-4-9-15/h5-6,10-11,14-15,18H,2-4,7-9,12-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | SDUXZZSSDSHHAI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|