C18H25Br2NO4 — CID 5069959
diethyl 2,4-bis(bromomethyl)-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarboxylate (PubChem CID 5069959) has the molecular formula C18H25Br2NO4 and a molecular weight of 479.21 g/mol. Its IUPAC name is diethyl 2,4-bis(bromomethyl)-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarboxylate.
| Compound Name | diethyl 2,4-bis(bromomethyl)-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 5069959 |
| Molecular Formula | C18H25Br2NO4 |
| Molecular Weight | 479.21 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | diethyl 2,4-bis(bromomethyl)-3-azaspiro[5.5]undeca-1,4-diene-1,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CBr)NC(CBr)=C(C(=O)OCC)C12CCCCC2 |
| InChI | InChI=1S/C18H25Br2NO4/c1-3-24-16(22)14-12(10-19)21-13(11-20)15(17(23)25-4-2)18(14)8-6-5-7-9-18/h21H,3-11H2,1-2H3 |
| InChIKey | YYYAGEZSOQOYAQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|