C12H12IN3O4 — CID 507025
3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-iodoprop-2-enenitrile (PubChem CID 507025) has the molecular formula C12H12IN3O4 and a molecular weight of 389.15 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-iodoprop-2-enenitrile.
| Compound Name | 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-iodoprop-2-enenitrile |
|---|---|
| PubChem CID | 507025 |
| Molecular Formula | C12H12IN3O4 |
| Molecular Weight | 389.15 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 3-[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-iodoprop-2-enenitrile |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](C=C(I)C#N)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H12IN3O4/c1-6-5-16(12(19)15-11(6)18)10-3-8(17)9(20-10)2-7(13)4-14/h2,5,8-10,17H,3H2,1H3,(H,15,18,19)/t8-,9+,10+/m0/s1 |
| InChIKey | YGJNQTOYAHXTQD-IVZWLZJFSA-N |
| XLogP | 0.34 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|