C11H14BN4O4 — CID 67823393
CID 67823393 (PubChem CID 67823393) has the molecular formula C11H14BN4O4 and a molecular weight of 277.07 g/mol.
| Compound Name | CID 67823393 |
|---|---|
| PubChem CID | 67823393 |
| Molecular Formula | C11H14BN4O4 |
| Molecular Weight | 277.07 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | — |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CN[B]C#N)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14BN4O4/c1-6-4-16(11(19)15-10(6)18)9-2-7(17)8(20-9)3-14-12-5-13/h4,7-9,14,17H,2-3H2,1H3,(H,15,18,19)/t7-,8+,9+/m0/s1 |
| InChIKey | AZLTWBCLWNGODQ-DJLDLDEBSA-N |
| XLogP | -1.82 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.07 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|