C14H21N3+2 — CID 5070524
3-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1H-indole (PubChem CID 5070524) has the molecular formula C14H21N3+2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1H-indole.
| Compound Name | 3-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 5070524 |
| Molecular Formula | C14H21N3+2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1H-indole |
| SMILES | C[NH+]1CC[NH+](Cc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C14H19N3/c1-16-6-8-17(9-7-16)11-12-10-15-14-5-3-2-4-13(12)14/h2-5,10,15H,6-9,11H2,1H3/p+2 |
| InChIKey | YLWXBMKGZWALKM-UHFFFAOYSA-P |
| XLogP | -0.92 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |