C22H20ClFN4O3S — CID 5072686
N-(3-chlorophenyl)-4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 5072686) has the molecular formula C22H20ClFN4O3S and a molecular weight of 474.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3-chlorophenyl)-4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 5072686 |
| Molecular Formula | C22H20ClFN4O3S |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-(3-chlorophenyl)-4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(F)c(S(=O)(=O)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C22H20ClFN4O3S/c23-17-4-3-5-18(15-17)26-22(29)16-7-8-19(24)20(14-16)32(30,31)28-12-10-27(11-13-28)21-6-1-2-9-25-21/h1-9,14-15H,10-13H2,(H,26,29) |
| InChIKey | BHAYOWLOJMKFCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |