C23H20F4N4O3S — CID 6616793
4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 6616793) has the molecular formula C23H20F4N4O3S and a molecular weight of 508.50 g/mol. Its IUPAC name is 4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 6616793 |
| Molecular Formula | C23H20F4N4O3S |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-fluoro-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(F)c(S(=O)(=O)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C23H20F4N4O3S/c24-19-8-7-16(22(32)29-18-5-3-4-17(15-18)23(25,26)27)14-20(19)35(33,34)31-12-10-30(11-13-31)21-6-1-2-9-28-21/h1-9,14-15H,10-13H2,(H,29,32) |
| InChIKey | BPANCEMQDVCSPC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |