C18H21NO6S — CID 507349
propan-2-yl 2-acetyloxy-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate (PubChem CID 507349) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is propan-2-yl 2-acetyloxy-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate.
| Compound Name | propan-2-yl 2-acetyloxy-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 507349 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | propan-2-yl 2-acetyloxy-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate |
| SMILES | CC(=O)Oc1ccc(NC(=O)C2=C(C)OCCS2)cc1C(=O)OC(C)C |
| InChI | InChI=1S/C18H21NO6S/c1-10(2)24-18(22)14-9-13(5-6-15(14)25-12(4)20)19-17(21)16-11(3)23-7-8-26-16/h5-6,9-10H,7-8H2,1-4H3,(H,19,21) |
| InChIKey | RAOZVVGJWWYCNV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|