C18H17ClN2 — CID 50739348
N-(4-chlorophenyl)-4,6,8-trimethylquinolin-2-amine (PubChem CID 50739348) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4,6,8-trimethylquinolin-2-amine.
| Compound Name | N-(4-chlorophenyl)-4,6,8-trimethylquinolin-2-amine |
|---|---|
| PubChem CID | 50739348 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-(4-chlorophenyl)-4,6,8-trimethylquinolin-2-amine |
| SMILES | Cc1cc(C)c2nc(Nc3ccc(Cl)cc3)cc(C)c2c1 |
| InChI | InChI=1S/C18H17ClN2/c1-11-8-13(3)18-16(9-11)12(2)10-17(21-18)20-15-6-4-14(19)5-7-15/h4-10H,1-3H3,(H,20,21) |
| InChIKey | BBSMCNORCFLYRB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |