C18H18BrClN2 — CID 56728926
N-(4-bromophenyl)-4,6,8-trimethylquinolin-2-amine;hydrochloride (PubChem CID 56728926) has the molecular formula C18H18BrClN2 and a molecular weight of 377.71 g/mol. Its IUPAC name is N-(4-bromophenyl)-4,6,8-trimethylquinolin-2-amine;hydrochloride.
| Compound Name | N-(4-bromophenyl)-4,6,8-trimethylquinolin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 56728926 |
| Molecular Formula | C18H18BrClN2 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-(4-bromophenyl)-4,6,8-trimethylquinolin-2-amine;hydrochloride |
| SMILES | Cc1cc(C)c2nc(Nc3ccc(Br)cc3)cc(C)c2c1.Cl |
| InChI | InChI=1S/C18H17BrN2.ClH/c1-11-8-13(3)18-16(9-11)12(2)10-17(21-18)20-15-6-4-14(19)5-7-15;/h4-10H,1-3H3,(H,20,21);1H |
| InChIKey | COBCFBBBLBAQHN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |