C20H24N4O — CID 5074023
N-cyclohexyl-N-(1H-imidazol-5-ylmethyl)-1-methylindole-3-carboxamide (PubChem CID 5074023) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-cyclohexyl-N-(1H-imidazol-5-ylmethyl)-1-methylindole-3-carboxamide.
| Compound Name | N-cyclohexyl-N-(1H-imidazol-5-ylmethyl)-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 5074023 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-cyclohexyl-N-(1H-imidazol-5-ylmethyl)-1-methylindole-3-carboxamide |
| SMILES | Cn1cc(C(=O)N(Cc2cnc[nH]2)C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H24N4O/c1-23-13-18(17-9-5-6-10-19(17)23)20(25)24(12-15-11-21-14-22-15)16-7-3-2-4-8-16/h5-6,9-11,13-14,16H,2-4,7-8,12H2,1H3,(H,21,22) |
| InChIKey | MKCMVVOYUDAXCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |