C22H27N3O3 — CID 50740552
3-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-phenylethyl]-1,1-diethylurea (PubChem CID 50740552) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-phenylethyl]-1,1-diethylurea.
| Compound Name | 3-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-phenylethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 50740552 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-phenylethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(c1ccccc1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C22H27N3O3/c1-3-24(4-2)22(28)23-13-17(14-8-6-5-7-9-14)25-20(26)18-15-10-11-16(12-15)19(18)21(25)27/h5-11,15-19H,3-4,12-13H2,1-2H3,(H,23,28) |
| InChIKey | FCFYYTNHBGQGSY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|