C12H5F4NO3 — CID 50742068
2,2,4,4-tetrafluoro-8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene (PubChem CID 50742068) has the molecular formula C12H5F4NO3 and a molecular weight of 287.17 g/mol. Its IUPAC name is 2,2,4,4-tetrafluoro-8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene.
| Compound Name | 2,2,4,4-tetrafluoro-8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene |
|---|---|
| PubChem CID | 50742068 |
| Molecular Formula | C12H5F4NO3 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2,2,4,4-tetrafluoro-8-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene |
| SMILES | O=[N+]([O-])c1ccc2c3c(cccc13)C(F)(F)OC2(F)F |
| InChI | InChI=1S/C12H5F4NO3/c13-11(14)7-3-1-2-6-9(17(18)19)5-4-8(10(6)7)12(15,16)20-11/h1-5H |
| InChIKey | QFXOSKXXBIKRMX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|