C20H22FN3O2S — CID 50744082
N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-fluorobenzamide (PubChem CID 50744082) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-fluorobenzamide.
| Compound Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 50744082 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-fluorobenzamide |
| SMILES | CCCCSc1cc2c(cc1NC(=O)c1ccccc1F)n(C)c(=O)n2C |
| InChI | InChI=1S/C20H22FN3O2S/c1-4-5-10-27-18-12-17-16(23(2)20(26)24(17)3)11-15(18)22-19(25)13-8-6-7-9-14(13)21/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,25) |
| InChIKey | BOSPLOWYRXSTBJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|