About 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine
7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 50749561) has the molecular formula C20H17ClN4
and a molecular weight of 348.84 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 50749561 |
| Molecular Formula | C20H17ClN4 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ncnc2c1c(-c1ccccc1)cn2-c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN4/c1-24(2)19-18-15(14-8-4-3-5-9-14)12-25(20(18)23-13-22-19)17-11-7-6-10-16(17)21/h3-13H,1-2H3 |
| InChIKey | LNXGZKAAYGZNDL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (CID 50749561) is 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is CN(C)c1ncnc2c1c(-c1ccccc1)cn2-c1ccccc1Cl.
What is the InChIKey of 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is LNXGZKAAYGZNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4/c1-24(2)19-18-15(14-8-4-3-5-9-14)12-25(20(18)23-13-22-19)17-11-7-6-10-16(17)21/h3-13H,1-2H3.
What are the key properties of 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 348.84 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-N,N-dimethyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 50749561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).