C16H19N3O5S — CID 50749811
N-(2-methoxyethyl)-6-(3-methoxyphenyl)-1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 50749811) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-(3-methoxyphenyl)-1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-(3-methoxyphenyl)-1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50749811 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(2-methoxyethyl)-6-(3-methoxyphenyl)-1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1c(-c2cccc(OC)c2)nc2n1CCS2(=O)=O |
| InChI | InChI=1S/C16H19N3O5S/c1-23-8-6-17-15(20)14-13(11-4-3-5-12(10-11)24-2)18-16-19(14)7-9-25(16,21)22/h3-5,10H,6-9H2,1-2H3,(H,17,20) |
| InChIKey | ZVWMWJNDKRZSEA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|