C20H16N4O4S2 — CID 50749873
N-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 50749873) has the molecular formula C20H16N4O4S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50749873 |
| Molecular Formula | C20H16N4O4S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1,1-dioxo-6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)c3c(-c4ccccc4)nc4n3CCS4(=O)=O)sc2c1 |
| InChI | InChI=1S/C20H16N4O4S2/c1-28-13-7-8-14-15(11-13)29-19(21-14)23-18(25)17-16(12-5-3-2-4-6-12)22-20-24(17)9-10-30(20,26)27/h2-8,11H,9-10H2,1H3,(H,21,23,25) |
| InChIKey | STXIAKWALRLJMC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |