C20H25N5O — CID 50749986
N-butyl-2-[5,7-dimethyl-2-(2-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide (PubChem CID 50749986) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-butyl-2-[5,7-dimethyl-2-(2-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide.
| Compound Name | N-butyl-2-[5,7-dimethyl-2-(2-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 50749986 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-butyl-2-[5,7-dimethyl-2-(2-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1c(C)nc2nc(-c3ccccc3C)nn2c1C |
| InChI | InChI=1S/C20H25N5O/c1-5-6-11-21-18(26)12-17-14(3)22-20-23-19(24-25(20)15(17)4)16-10-8-7-9-13(16)2/h7-10H,5-6,11-12H2,1-4H3,(H,21,26) |
| InChIKey | PWXSXLGMLDTIKB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|