C22H20N4O4 — CID 50755093
3-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl]propanamide (PubChem CID 50755093) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 50755093 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-phenylethyl)-1,2,4-oxadiazol-3-yl]methyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NCc1noc(CCc2ccccc2)n1 |
| InChI | InChI=1S/C22H20N4O4/c27-19(12-13-26-21(28)16-8-4-5-9-17(16)22(26)29)23-14-18-24-20(30-25-18)11-10-15-6-2-1-3-7-15/h1-9H,10-14H2,(H,23,27) |
| InChIKey | RVWOPPHVMGSJPQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|