C27H33N3O3 — CID 50756821
N-(2,3-dimethylcyclohexyl)-10-(2,3-dimethylphenyl)-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 50756821) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-10-(2,3-dimethylphenyl)-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-10-(2,3-dimethylphenyl)-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 50756821 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-10-(2,3-dimethylphenyl)-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1cccc(N2C(=O)c3cc4occc4n3CC2(C)C(=O)NC2CCCC(C)C2C)c1C |
| InChI | InChI=1S/C27H33N3O3/c1-16-8-6-10-20(18(16)3)28-26(32)27(5)15-29-22-12-13-33-24(22)14-23(29)25(31)30(27)21-11-7-9-17(2)19(21)4/h7,9,11-14,16,18,20H,6,8,10,15H2,1-5H3,(H,28,32) |
| InChIKey | OGSNZCWXZMEMQV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |