C25H35N3O3 — CID 71219796
10-cyclohexyl-N-[(1R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 71219796) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 10-cyclohexyl-N-[(1R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | 10-cyclohexyl-N-[(1R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 71219796 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 10-cyclohexyl-N-[(1R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CC1CCC[C@@H](NC(=O)C2(C)Cn3c(cc4occc43)C(=O)N2C2CCCCC2)C1C |
| InChI | InChI=1S/C25H35N3O3/c1-16-8-7-11-19(17(16)2)26-24(30)25(3)15-27-20-12-13-31-22(20)14-21(27)23(29)28(25)18-9-5-4-6-10-18/h12-14,16-19H,4-11,15H2,1-3H3,(H,26,30)/t16?,17?,19-,25?/m1/s1 |
| InChIKey | OPCMACPDNPUXRD-DHBVXDHESA-N |
| XLogP | 4.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |