C26H37N3O3 — CID 92738108
(11R)-10-cycloheptyl-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92738108) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is (11R)-10-cycloheptyl-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11R)-10-cycloheptyl-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92738108 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (11R)-10-cycloheptyl-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-11-methyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@]1(C)Cn2c(cc3occc32)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C26H37N3O3/c1-17-9-8-12-20(18(17)2)27-25(31)26(3)16-28-21-13-14-32-23(21)15-22(28)24(30)29(26)19-10-6-4-5-7-11-19/h13-15,17-20H,4-12,16H2,1-3H3,(H,27,31)/t17-,18-,20+,26-/m1/s1 |
| InChIKey | NQLOBCDLLTUWMK-CKWPORTCSA-N |
| XLogP | 5.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |