C27H24ClN3O4 — CID 50759021
methyl 2-[[6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate (PubChem CID 50759021) has the molecular formula C27H24ClN3O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is methyl 2-[[6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 50759021 |
| Molecular Formula | C27H24ClN3O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | methyl 2-[[6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H24ClN3O4/c1-34-18-10-7-16(8-11-18)25-24-19(21-15-17(28)9-12-23(21)29-24)13-14-31(25)27(33)30-22-6-4-3-5-20(22)26(32)35-2/h3-12,15,25,29H,13-14H2,1-2H3,(H,30,33) |
| InChIKey | QKKLITDYULGDTP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|