C20H14ClN3O4S2 — CID 50761994
N-[2-(4-chlorophenyl)ethyl]-8-oxo-3-sulfanylidene-12,14-dioxa-4-thia-2,7-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),5,9,11(15)-tetraene-5-carboxamide (PubChem CID 50761994) has the molecular formula C20H14ClN3O4S2 and a molecular weight of 459.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-8-oxo-3-sulfanylidene-12,14-dioxa-4-thia-2,7-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),5,9,11(15)-tetraene-5-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-8-oxo-3-sulfanylidene-12,14-dioxa-4-thia-2,7-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),5,9,11(15)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 50761994 |
| Molecular Formula | C20H14ClN3O4S2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-8-oxo-3-sulfanylidene-12,14-dioxa-4-thia-2,7-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),5,9,11(15)-tetraene-5-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1sc(=S)n2c1[nH]c(=O)c1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C20H14ClN3O4S2/c21-11-3-1-10(2-4-11)5-6-22-19(26)16-17-23-18(25)12-7-14-15(28-9-27-14)8-13(12)24(17)20(29)30-16/h1-4,7-8H,5-6,9H2,(H,22,26)(H,23,25) |
| InChIKey | URMLYCMGJOBIPV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|