C24H23N5O2S — CID 50762098
N-[2-(cyclohexen-1-yl)ethyl]-3-[(5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazolin-2-yl)amino]benzamide (PubChem CID 50762098) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazolin-2-yl)amino]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 50762098 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazolin-2-yl)amino]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccc(Nc2nn3c(=O)c4ccccc4nc3s2)c1 |
| InChI | InChI=1S/C24H23N5O2S/c30-21(25-14-13-16-7-2-1-3-8-16)17-9-6-10-18(15-17)26-23-28-29-22(31)19-11-4-5-12-20(19)27-24(29)32-23/h4-7,9-12,15H,1-3,8,13-14H2,(H,25,30)(H,26,28) |
| InChIKey | NNYREUMVQYDXDX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|