C20H22N4O3S3 — CID 50769761
2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(4-butylphenyl)acetamide (PubChem CID 50769761) has the molecular formula C20H22N4O3S3 and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(4-butylphenyl)acetamide.
| Compound Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(4-butylphenyl)acetamide |
|---|---|
| PubChem CID | 50769761 |
| Molecular Formula | C20H22N4O3S3 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-(4-amino-5-thiophen-2-ylsulfonylpyrimidin-2-yl)sulfanyl-N-(4-butylphenyl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2ncc(S(=O)(=O)c3cccs3)c(N)n2)cc1 |
| InChI | InChI=1S/C20H22N4O3S3/c1-2-3-5-14-7-9-15(10-8-14)23-17(25)13-29-20-22-12-16(19(21)24-20)30(26,27)18-6-4-11-28-18/h4,6-12H,2-3,5,13H2,1H3,(H,23,25)(H2,21,22,24) |
| InChIKey | JLYUZVZTAYJOSG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |