C36H31Cl2N3O8 — CID 5077195
8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5077195) has the molecular formula C36H31Cl2N3O8 and a molecular weight of 704.56 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5077195 |
| Molecular Formula | C36H31Cl2N3O8 |
| Molecular Weight | 704.56 g/mol |
| Exact Mass | 703.15 |
| IUPAC Name | 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(O)C(=O)C42)C3C=Cc2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C36H31Cl2N3O8/c1-48-21-8-5-19(6-9-21)36-25(12-3-18-4-14-29(42)30(15-18)49-2)22-10-11-23-31(34(45)41(47)32(23)43)24(22)17-26(36)33(44)40(35(36)46)39-28-13-7-20(37)16-27(28)38/h3-10,12-16,23-26,31,39,42,47H,11,17H2,1-2H3 |
| InChIKey | IEBPSLXRGLGKHP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|