C24H20ClNO2S — CID 50774388
2-(2-chlorophenyl)-4-hydroxy-1-[(4-methylsulfanylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one (PubChem CID 50774388) has the molecular formula C24H20ClNO2S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-hydroxy-1-[(4-methylsulfanylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one.
| Compound Name | 2-(2-chlorophenyl)-4-hydroxy-1-[(4-methylsulfanylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 50774388 |
| Molecular Formula | C24H20ClNO2S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-(2-chlorophenyl)-4-hydroxy-1-[(4-methylsulfanylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
| SMILES | CSc1ccc(CN2C(=O)C(O)=C(c3ccccc3)C2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H20ClNO2S/c1-29-18-13-11-16(12-14-18)15-26-22(19-9-5-6-10-20(19)25)21(23(27)24(26)28)17-7-3-2-4-8-17/h2-14,22,27H,15H2,1H3 |
| InChIKey | ZQEQYVZLRBWPDK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |