C13H14N3O3S2- — CID 5078003
[4-(2-methylpropanoylamino)phenyl]sulfonyl-(1,3-thiazol-2-yl)azanide (PubChem CID 5078003) has the molecular formula C13H14N3O3S2- and a molecular weight of 324.41 g/mol. Its IUPAC name is [4-(2-methylpropanoylamino)phenyl]sulfonyl-(1,3-thiazol-2-yl)azanide.
| Compound Name | [4-(2-methylpropanoylamino)phenyl]sulfonyl-(1,3-thiazol-2-yl)azanide |
|---|---|
| PubChem CID | 5078003 |
| Molecular Formula | C13H14N3O3S2- |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [4-(2-methylpropanoylamino)phenyl]sulfonyl-(1,3-thiazol-2-yl)azanide |
| SMILES | CC(C)C(=O)Nc1ccc(S(=O)(=O)[N-]c2nccs2)cc1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-9(2)12(17)15-10-3-5-11(6-4-10)21(18,19)16-13-14-7-8-20-13/h3-9H,1-2H3,(H2,14,15,16,17)/p-1 |
| InChIKey | XSGYYRGPRPKDND-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |