C21H19ClN4O2S — CID 50780899
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-methyl-3-oxoquinoxalin-2-yl)sulfanylacetamide (PubChem CID 50780899) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-methyl-3-oxoquinoxalin-2-yl)sulfanylacetamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-methyl-3-oxoquinoxalin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 50780899 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-methyl-3-oxoquinoxalin-2-yl)sulfanylacetamide |
| SMILES | Cn1c(=O)c(SCC(=O)NCCc2c[nH]c3ccc(Cl)cc23)nc2ccccc21 |
| InChI | InChI=1S/C21H19ClN4O2S/c1-26-18-5-3-2-4-17(18)25-20(21(26)28)29-12-19(27)23-9-8-13-11-24-16-7-6-14(22)10-15(13)16/h2-7,10-11,24H,8-9,12H2,1H3,(H,23,27) |
| InChIKey | GMNGJFTZUMBUFZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |