C24H19FN4O4 — CID 507826
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 507826) has the molecular formula C24H19FN4O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507826 |
| Molecular Formula | C24H19FN4O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-c3cnco3)ccc(F)c12 |
| InChI | InChI=1S/C24H19FN4O4/c25-18-7-6-16(19-13-26-14-33-19)21-20(18)17(12-27-21)22(30)24(32)29-10-8-28(9-11-29)23(31)15-4-2-1-3-5-15/h1-7,12-14,27H,8-11H2 |
| InChIKey | YUBUIMRLUDWMJJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|