C20H23ClN6O2 — CID 50783316
1-[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 50783316) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50783316 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(c2ccc3nnc(-c4ccccc4Cl)n3n2)CC1 |
| InChI | InChI=1S/C20H23ClN6O2/c1-29-13-10-22-20(28)14-8-11-26(12-9-14)18-7-6-17-23-24-19(27(17)25-18)15-4-2-3-5-16(15)21/h2-7,14H,8-13H2,1H3,(H,22,28) |
| InChIKey | ZGJKTSPXCNHNKN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|