C28H32N4O3 — CID 50784104
6-[(3-methylbenzoyl)amino]-2-(4-piperidin-1-ylpiperidin-1-yl)quinoline-4-carboxylic acid (PubChem CID 50784104) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 6-[(3-methylbenzoyl)amino]-2-(4-piperidin-1-ylpiperidin-1-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-[(3-methylbenzoyl)amino]-2-(4-piperidin-1-ylpiperidin-1-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 50784104 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 6-[(3-methylbenzoyl)amino]-2-(4-piperidin-1-ylpiperidin-1-yl)quinoline-4-carboxylic acid |
| SMILES | Cc1cccc(C(=O)Nc2ccc3nc(N4CCC(N5CCCCC5)CC4)cc(C(=O)O)c3c2)c1 |
| InChI | InChI=1S/C28H32N4O3/c1-19-6-5-7-20(16-19)27(33)29-21-8-9-25-23(17-21)24(28(34)35)18-26(30-25)32-14-10-22(11-15-32)31-12-3-2-4-13-31/h5-9,16-18,22H,2-4,10-15H2,1H3,(H,29,33)(H,34,35) |
| InChIKey | HYYLFZBUCAQAFP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |