C27H23FN4O4S — CID 507851
3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-N-(thiophen-2-ylmethyl)-1H-indole-7-carboxamide (PubChem CID 507851) has the molecular formula C27H23FN4O4S and a molecular weight of 518.57 g/mol. Its IUPAC name is 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-N-(thiophen-2-ylmethyl)-1H-indole-7-carboxamide.
| Compound Name | 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-N-(thiophen-2-ylmethyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 507851 |
| Molecular Formula | C27H23FN4O4S |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-N-(thiophen-2-ylmethyl)-1H-indole-7-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C27H23FN4O4S/c28-21-9-8-19(25(34)30-15-18-7-4-14-37-18)23-22(21)20(16-29-23)24(33)27(36)32-12-10-31(11-13-32)26(35)17-5-2-1-3-6-17/h1-9,14,16,29H,10-13,15H2,(H,30,34) |
| InChIKey | OYNOSCALHDSOBA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|