C17H17N5O7S2 — CID 5078556
2-[2-[(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 5078556) has the molecular formula C17H17N5O7S2 and a molecular weight of 467.49 g/mol. Its IUPAC name is 2-[2-[(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[2-[(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 5078556 |
| Molecular Formula | C17H17N5O7S2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-[2-[(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)Nc2cc(C)on2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H17N5O7S2/c1-3-21-12-5-4-11(22(25)26)7-13(12)30-17(21)19-16(24)9-31(27,28)8-15(23)18-14-6-10(2)29-20-14/h4-7H,3,8-9H2,1-2H3,(H,18,20,23)/b19-17- |
| InChIKey | NLZMKBPAPNZMKE-ZPHPHTNESA-N |
| XLogP | 1.41 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|