C21H17N5O6S3 — CID 3268216
2-[2-[(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3268216) has the molecular formula C21H17N5O6S3 and a molecular weight of 531.60 g/mol. Its IUPAC name is 2-[2-[(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[2-[(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3268216 |
| Molecular Formula | C21H17N5O6S3 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 2-[2-[(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfonyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cn1/c(=N/C(=O)CS(=O)(=O)CC(=O)Nc2nc(-c3ccccc3)cs2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H17N5O6S3/c1-25-16-8-7-14(26(29)30)9-17(16)34-21(25)24-19(28)12-35(31,32)11-18(27)23-20-22-15(10-33-20)13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,22,23,27)/b24-21- |
| InChIKey | CCYZFPCSEOUBKB-FLFQWRMESA-N |
| XLogP | 2.75 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|