C21H24BrN3O2 — CID 50789043
3-[3-[(3-bromophenyl)methylcarbamoyl]phenyl]-N-methylpiperidine-1-carboxamide (PubChem CID 50789043) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 3-[3-[(3-bromophenyl)methylcarbamoyl]phenyl]-N-methylpiperidine-1-carboxamide.
| Compound Name | 3-[3-[(3-bromophenyl)methylcarbamoyl]phenyl]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 50789043 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-[3-[(3-bromophenyl)methylcarbamoyl]phenyl]-N-methylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCCC(c2cccc(C(=O)NCc3cccc(Br)c3)c2)C1 |
| InChI | InChI=1S/C21H24BrN3O2/c1-23-21(27)25-10-4-8-18(14-25)16-6-3-7-17(12-16)20(26)24-13-15-5-2-9-19(22)11-15/h2-3,5-7,9,11-12,18H,4,8,10,13-14H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | NBPGOVOBCVGDDQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |