C27H25N3O4 — CID 50793854
4-[[3,4-dimethyl-1-(4-methylphenyl)pyrazolo[5,4-b]pyridin-6-yl]oxymethyl]-6-ethoxychromen-2-one (PubChem CID 50793854) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[[3,4-dimethyl-1-(4-methylphenyl)pyrazolo[5,4-b]pyridin-6-yl]oxymethyl]-6-ethoxychromen-2-one.
| Compound Name | 4-[[3,4-dimethyl-1-(4-methylphenyl)pyrazolo[5,4-b]pyridin-6-yl]oxymethyl]-6-ethoxychromen-2-one |
|---|---|
| PubChem CID | 50793854 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-[[3,4-dimethyl-1-(4-methylphenyl)pyrazolo[5,4-b]pyridin-6-yl]oxymethyl]-6-ethoxychromen-2-one |
| SMILES | CCOc1ccc2oc(=O)cc(COc3cc(C)c4c(C)nn(-c5ccc(C)cc5)c4n3)c2c1 |
| InChI | InChI=1S/C27H25N3O4/c1-5-32-21-10-11-23-22(14-21)19(13-25(31)34-23)15-33-24-12-17(3)26-18(4)29-30(27(26)28-24)20-8-6-16(2)7-9-20/h6-14H,5,15H2,1-4H3 |
| InChIKey | FHOKOXSXTQMLJA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|