C17H16FN3O3 — CID 50796699
1-(3-fluorophenyl)-3-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)urea (PubChem CID 50796699) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-(3-fluorophenyl)-3-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 50796699 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)urea |
| SMILES | CC(C)n1c(=O)oc2cc(NC(=O)Nc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C17H16FN3O3/c1-10(2)21-14-7-6-13(9-15(14)24-17(21)23)20-16(22)19-12-5-3-4-11(18)8-12/h3-10H,1-2H3,(H2,19,20,22) |
| InChIKey | IJHXVNZTCNLCIJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |