C19H29N3O5S — CID 160739803
1-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)-3-(5-propan-2-ylsulfonylpentyl)urea (PubChem CID 160739803) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)-3-(5-propan-2-ylsulfonylpentyl)urea.
| Compound Name | 1-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)-3-(5-propan-2-ylsulfonylpentyl)urea |
|---|---|
| PubChem CID | 160739803 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-(2-oxo-3-propan-2-yl-1,3-benzoxazol-6-yl)-3-(5-propan-2-ylsulfonylpentyl)urea |
| SMILES | CC(C)n1c(=O)oc2cc(NC(=O)NCCCCCS(=O)(=O)C(C)C)ccc21 |
| InChI | InChI=1S/C19H29N3O5S/c1-13(2)22-16-9-8-15(12-17(16)27-19(22)24)21-18(23)20-10-6-5-7-11-28(25,26)14(3)4/h8-9,12-14H,5-7,10-11H2,1-4H3,(H2,20,21,23) |
| InChIKey | RVKQNNIFHVNSRJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|