C10H10FNO2 — CID 89210533
6-fluoro-3-propan-2-yl-1,3-benzoxazol-2-one (PubChem CID 89210533) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 6-fluoro-3-propan-2-yl-1,3-benzoxazol-2-one.
| Compound Name | 6-fluoro-3-propan-2-yl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 89210533 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 6-fluoro-3-propan-2-yl-1,3-benzoxazol-2-one |
| SMILES | CC(C)n1c(=O)oc2cc(F)ccc21 |
| InChI | InChI=1S/C10H10FNO2/c1-6(2)12-8-4-3-7(11)5-9(8)14-10(12)13/h3-6H,1-2H3 |
| InChIKey | FQUJKSRIAOKAIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |